C21H23BrFNO3 — CID 53267301
(E)-N-(4-bromo-2-fluorophenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide (PubChem CID 53267301) has the molecular formula C21H23BrFNO3 and a molecular weight of 436.32 g/mol. Its IUPAC name is (E)-N-(4-bromo-2-fluorophenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-bromo-2-fluorophenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53267301 |
| Molecular Formula | C21H23BrFNO3 |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | (E)-N-(4-bromo-2-fluorophenyl)-3-(3-methoxy-4-pentoxyphenyl)prop-2-enamide |
| SMILES | CCCCCOc1ccc(/C=C/C(=O)Nc2ccc(Br)cc2F)cc1OC |
| InChI | InChI=1S/C21H23BrFNO3/c1-3-4-5-12-27-19-10-6-15(13-20(19)26-2)7-11-21(25)24-18-9-8-16(22)14-17(18)23/h6-11,13-14H,3-5,12H2,1-2H3,(H,24,25)/b11-7+ |
| InChIKey | QXLJYTITLZTHBL-YRNVUSSQSA-N |
| XLogP | 5.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|