C24H21BrFNO3 — CID 53267331
(E)-N-(4-bromo-2-fluorophenyl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 53267331) has the molecular formula C24H21BrFNO3 and a molecular weight of 470.34 g/mol. Its IUPAC name is (E)-N-(4-bromo-2-fluorophenyl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-bromo-2-fluorophenyl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 53267331 |
| Molecular Formula | C24H21BrFNO3 |
| Molecular Weight | 470.34 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | (E)-N-(4-bromo-2-fluorophenyl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(Br)cc2F)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C24H21BrFNO3/c1-16-5-3-4-6-18(16)15-30-22-11-7-17(13-23(22)29-2)8-12-24(28)27-21-10-9-19(25)14-20(21)26/h3-14H,15H2,1-2H3,(H,27,28)/b12-8+ |
| InChIKey | BCMIJLPKRSOITP-XYOKQWHBSA-N |
| XLogP | 6.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.34 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|