C26H26ClNO5 — CID 3610452
N-(4-chloro-2,5-dimethoxyphenyl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 3610452) has the molecular formula C26H26ClNO5 and a molecular weight of 467.95 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3610452 |
| Molecular Formula | C26H26ClNO5 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | COc1cc(NC(=O)C=Cc2ccc(OCc3ccccc3C)c(OC)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C26H26ClNO5/c1-17-7-5-6-8-19(17)16-33-22-11-9-18(13-25(22)32-4)10-12-26(29)28-21-15-23(30-2)20(27)14-24(21)31-3/h5-15H,16H2,1-4H3,(H,28,29) |
| InChIKey | ANCVBRGXOMNMJV-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|