C21H24ClNO5 — CID 4224141
N-(4-chloro-2,5-dimethoxyphenyl)-3-(3-methoxy-4-propoxyphenyl)prop-2-enamide (PubChem CID 4224141) has the molecular formula C21H24ClNO5 and a molecular weight of 405.88 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-3-(3-methoxy-4-propoxyphenyl)prop-2-enamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(3-methoxy-4-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4224141 |
| Molecular Formula | C21H24ClNO5 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-(3-methoxy-4-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccc(C=CC(=O)Nc2cc(OC)c(Cl)cc2OC)cc1OC |
| InChI | InChI=1S/C21H24ClNO5/c1-5-10-28-17-8-6-14(11-20(17)27-4)7-9-21(24)23-16-13-18(25-2)15(22)12-19(16)26-3/h6-9,11-13H,5,10H2,1-4H3,(H,23,24) |
| InChIKey | JDWQWNYEFUJSTG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|