C17H16ClNO4 — CID 84551958
(E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-enamide (PubChem CID 84551958) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 84551958 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/c2ccc(O)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H16ClNO4/c1-22-15-10-14(16(23-2)9-13(15)18)19-17(21)8-5-11-3-6-12(20)7-4-11/h3-10,20H,1-2H3,(H,19,21)/b8-5+ |
| InChIKey | MEBGOYNWACRUOF-VMPITWQZSA-N |
| XLogP | 3.71 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|