C17H14Cl3NO3 — CID 1181184
(E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 1181184) has the molecular formula C17H14Cl3NO3 and a molecular weight of 386.66 g/mol. Its IUPAC name is (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1181184 |
| Molecular Formula | C17H14Cl3NO3 |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | (E)-N-(4-chloro-2,5-dimethoxyphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C=C/c2ccc(Cl)cc2Cl)c(OC)cc1Cl |
| InChI | InChI=1S/C17H14Cl3NO3/c1-23-15-9-14(16(24-2)8-13(15)20)21-17(22)6-4-10-3-5-11(18)7-12(10)19/h3-9H,1-2H3,(H,21,22)/b6-4+ |
| InChIKey | CWJQQFDJJWAZSO-GQCTYLIASA-N |
| XLogP | 5.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|