C18H14Cl3NO4 — CID 1183481
methyl 5-chloro-4-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-2-methoxybenzoate (PubChem CID 1183481) has the molecular formula C18H14Cl3NO4 and a molecular weight of 414.67 g/mol. Its IUPAC name is methyl 5-chloro-4-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-2-methoxybenzoate.
| Compound Name | methyl 5-chloro-4-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 1183481 |
| Molecular Formula | C18H14Cl3NO4 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | methyl 5-chloro-4-[3-(2,4-dichlorophenyl)prop-2-enoylamino]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(Cl)c(NC(=O)C=Cc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C18H14Cl3NO4/c1-25-16-9-15(14(21)8-12(16)18(24)26-2)22-17(23)6-4-10-3-5-11(19)7-13(10)20/h3-9H,1-2H3,(H,22,23) |
| InChIKey | ROPXNRJFIRYIKM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|