C26H23Cl2NO6 — CID 4691963
methyl 5-chloro-4-[3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoylamino]-2-methoxybenzoate (PubChem CID 4691963) has the molecular formula C26H23Cl2NO6 and a molecular weight of 516.38 g/mol. Its IUPAC name is methyl 5-chloro-4-[3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoylamino]-2-methoxybenzoate.
| Compound Name | methyl 5-chloro-4-[3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoylamino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 4691963 |
| Molecular Formula | C26H23Cl2NO6 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | methyl 5-chloro-4-[3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enoylamino]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(Cl)c(NC(=O)C=Cc2ccc(OCc3ccc(Cl)cc3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C26H23Cl2NO6/c1-32-23-14-21(20(28)13-19(23)26(31)34-3)29-25(30)11-7-16-6-10-22(24(12-16)33-2)35-15-17-4-8-18(27)9-5-17/h4-14H,15H2,1-3H3,(H,29,30) |
| InChIKey | MJSJJXSMMSGQIB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|