C24H19ClN2O3S — CID 2789342
N-(1,3-benzothiazol-2-yl)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide (PubChem CID 2789342) has the molecular formula C24H19ClN2O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 2789342 |
| Molecular Formula | C24H19ClN2O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2nc3ccccc3s2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19ClN2O3S/c1-29-21-14-16(8-12-20(21)30-15-17-6-10-18(25)11-7-17)9-13-23(28)27-24-26-19-4-2-3-5-22(19)31-24/h2-14H,15H2,1H3,(H,26,27,28) |
| InChIKey | HDOAQEJINUUQEF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|