C27H23ClN2O4S — CID 3426042
3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 3426042) has the molecular formula C27H23ClN2O4S and a molecular weight of 507.01 g/mol. Its IUPAC name is 3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3426042 |
| Molecular Formula | C27H23ClN2O4S |
| Molecular Weight | 507.01 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 3-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1cccc(-c2csc(NC(=O)C=Cc3ccc(OCc4ccc(Cl)cc4)c(OC)c3)n2)c1 |
| InChI | InChI=1S/C27H23ClN2O4S/c1-32-22-5-3-4-20(15-22)23-17-35-27(29-23)30-26(31)13-9-18-8-12-24(25(14-18)33-2)34-16-19-6-10-21(28)11-7-19/h3-15,17H,16H2,1-2H3,(H,29,30,31) |
| InChIKey | UGPIHLVZTLCUTC-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.01 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|