C26H21N3O5S — CID 4287739
3-(3-methoxy-4-phenylmethoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 4287739) has the molecular formula C26H21N3O5S and a molecular weight of 487.54 g/mol. Its IUPAC name is 3-(3-methoxy-4-phenylmethoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(3-methoxy-4-phenylmethoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4287739 |
| Molecular Formula | C26H21N3O5S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 3-(3-methoxy-4-phenylmethoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H21N3O5S/c1-33-24-15-18(7-13-23(24)34-16-19-5-3-2-4-6-19)8-14-25(30)28-26-27-22(17-35-26)20-9-11-21(12-10-20)29(31)32/h2-15,17H,16H2,1H3,(H,27,28,30) |
| InChIKey | SIZVWGXAXAPZBM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|