C27H24N2O4S — CID 19212203
(E)-3-(3-methoxy-4-phenylmethoxyphenyl)-N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 19212203) has the molecular formula C27H24N2O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-phenylmethoxyphenyl)-N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3-methoxy-4-phenylmethoxyphenyl)-N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 19212203 |
| Molecular Formula | C27H24N2O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (E)-3-(3-methoxy-4-phenylmethoxyphenyl)-N-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2nc(-c3ccccc3OC)cs2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H24N2O4S/c1-31-23-11-7-6-10-21(23)22-18-34-27(28-22)29-26(30)15-13-19-12-14-24(25(16-19)32-2)33-17-20-8-4-3-5-9-20/h3-16,18H,17H2,1-2H3,(H,28,29,30)/b15-13+ |
| InChIKey | NULLORQOQMTSSA-FYWRMAATSA-N |
| XLogP | 6.06 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|