C25H22N2O3S — CID 108756821
(E)-3-(4-ethoxy-3-methoxyphenyl)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 108756821) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is (E)-3-(4-ethoxy-3-methoxyphenyl)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-ethoxy-3-methoxyphenyl)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108756821 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (E)-3-(4-ethoxy-3-methoxyphenyl)-N-(4-naphthalen-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2nc(-c3ccc4ccccc4c3)cs2)cc1OC |
| InChI | InChI=1S/C25H22N2O3S/c1-3-30-22-12-8-17(14-23(22)29-2)9-13-24(28)27-25-26-21(16-31-25)20-11-10-18-6-4-5-7-19(18)15-20/h4-16H,3H2,1-2H3,(H,26,27,28)/b13-9+ |
| InChIKey | KCCJGBUGWUVUNB-UKTHLTGXSA-N |
| XLogP | 6.02 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|