C27H32N2O3S — CID 4074908
N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 4074908) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4074908 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCOc1ccc(C=CC(=O)Nc2nc(-c3ccc(C)c(C)c3)cs2)cc1OC |
| InChI | InChI=1S/C27H32N2O3S/c1-5-6-7-8-15-32-24-13-10-21(17-25(24)31-4)11-14-26(30)29-27-28-23(18-33-27)22-12-9-19(2)20(3)16-22/h9-14,16-18H,5-8,15H2,1-4H3,(H,28,29,30) |
| InChIKey | IFUFBYHPZOTZEE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|