C24H26N2O3S — CID 4086189
3-(3,4-diethoxyphenyl)-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 4086189) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(3,4-diethoxyphenyl)-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4086189 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-N-[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | CCOc1ccc(C=CC(=O)Nc2nc(-c3ccc(C)c(C)c3)cs2)cc1OCC |
| InChI | InChI=1S/C24H26N2O3S/c1-5-28-21-11-8-18(14-22(21)29-6-2)9-12-23(27)26-24-25-20(15-30-24)19-10-7-16(3)17(4)13-19/h7-15H,5-6H2,1-4H3,(H,25,26,27) |
| InChIKey | QEJHLUNYRKRBTM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|