C24H26N2O4S — CID 1194434
(E)-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide (PubChem CID 1194434) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is (E)-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1194434 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (E)-N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(-c2csc(NC(=O)/C=C/c3ccc(OC(C)C)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-5-29-19-10-8-18(9-11-19)20-15-31-24(25-20)26-23(27)13-7-17-6-12-21(30-16(2)3)22(14-17)28-4/h6-16H,5H2,1-4H3,(H,25,26,27)/b13-7+ |
| InChIKey | NEDCVFGMUSCQIM-NTUHNPAUSA-N |
| XLogP | 5.66 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|