C25H27FN2O3S — CID 4074907
N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 4074907) has the molecular formula C25H27FN2O3S and a molecular weight of 454.57 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4074907 |
| Molecular Formula | C25H27FN2O3S |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCOc1ccc(C=CC(=O)Nc2nc(-c3ccc(F)cc3)cs2)cc1OC |
| InChI | InChI=1S/C25H27FN2O3S/c1-3-4-5-6-15-31-22-13-7-18(16-23(22)30-2)8-14-24(29)28-25-27-21(17-32-25)19-9-11-20(26)12-10-19/h7-14,16-17H,3-6,15H2,1-2H3,(H,27,28,29) |
| InChIKey | QGNLLWJTGLJPJC-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|