C21H20N2O3S — CID 4184713
3-(4-ethoxyphenyl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 4184713) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(4-ethoxyphenyl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4184713 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3-(4-ethoxyphenyl)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | CCOc1ccc(C=CC(=O)Nc2nc(-c3ccc(OC)cc3)cs2)cc1 |
| InChI | InChI=1S/C21H20N2O3S/c1-3-26-18-9-4-15(5-10-18)6-13-20(24)23-21-22-19(14-27-21)16-7-11-17(25-2)12-8-16/h4-14H,3H2,1-2H3,(H,22,23,24) |
| InChIKey | XPZYIESCCBCXEA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|