C23H21F3N2O3S — CID 76542037
N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-[4-(4,4,4-trifluorobutoxy)phenyl]prop-2-enamide (PubChem CID 76542037) has the molecular formula C23H21F3N2O3S and a molecular weight of 462.49 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-[4-(4,4,4-trifluorobutoxy)phenyl]prop-2-enamide.
| Compound Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-[4-(4,4,4-trifluorobutoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76542037 |
| Molecular Formula | C23H21F3N2O3S |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-[4-(4,4,4-trifluorobutoxy)phenyl]prop-2-enamide |
| SMILES | COc1ccc(-c2csc(NC(=O)C=Cc3ccc(OCCCC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C23H21F3N2O3S/c1-30-18-10-6-17(7-11-18)20-15-32-22(27-20)28-21(29)12-5-16-3-8-19(9-4-16)31-14-2-13-23(24,25)26/h3-12,15H,2,13-14H2,1H3,(H,27,28,29) |
| InChIKey | YEZCMNKGWXLZKR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|