C27H21F3N2O2S2 — CID 87722121
(E)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-[4-[[4-(trifluoromethyl)phenyl]methylsulfanyl]phenyl]prop-2-enamide (PubChem CID 87722121) has the molecular formula C27H21F3N2O2S2 and a molecular weight of 526.61 g/mol. Its IUPAC name is (E)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-[4-[[4-(trifluoromethyl)phenyl]methylsulfanyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-[4-[[4-(trifluoromethyl)phenyl]methylsulfanyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 87722121 |
| Molecular Formula | C27H21F3N2O2S2 |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | (E)-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-[4-[[4-(trifluoromethyl)phenyl]methylsulfanyl]phenyl]prop-2-enamide |
| SMILES | COc1ccc(-c2csc(NC(=O)/C=C/c3ccc(SCc4ccc(C(F)(F)F)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C27H21F3N2O2S2/c1-34-22-11-7-20(8-12-22)24-17-36-26(31-24)32-25(33)15-6-18-4-13-23(14-5-18)35-16-19-2-9-21(10-3-19)27(28,29)30/h2-15,17H,16H2,1H3,(H,31,32,33)/b15-6+ |
| InChIKey | WZUJZLVIKGCOCI-GIDUJCDVSA-N |
| XLogP | 7.78 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|