C21H20N2OS — CID 4259251
N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 4259251) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4259251 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[4-(4-ethylphenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | CCc1ccc(-c2csc(NC(=O)C=Cc3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C21H20N2OS/c1-3-16-8-11-18(12-9-16)19-14-25-21(22-19)23-20(24)13-10-17-6-4-15(2)5-7-17/h4-14H,3H2,1-2H3,(H,22,23,24) |
| InChIKey | YSNKSYJDUJNTAU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|