C20H17N3OS2 — CID 2183439
(Z)-N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 2183439) has the molecular formula C20H17N3OS2 and a molecular weight of 379.51 g/mol. Its IUPAC name is (Z)-N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 2183439 |
| Molecular Formula | C20H17N3OS2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (Z)-N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc(-c2csc(NC(=S)NC(=O)/C=C\c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H17N3OS2/c1-14-7-10-16(11-8-14)17-13-26-20(21-17)23-19(25)22-18(24)12-9-15-5-3-2-4-6-15/h2-13H,1H3,(H2,21,22,23,24,25)/b12-9- |
| InChIKey | ZNTRPSKBWVCPFP-XFXZXTDPSA-N |
| XLogP | 4.64 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|