C15H15N3OS2 — CID 164687675
N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]cyclopropanecarboxamide (PubChem CID 164687675) has the molecular formula C15H15N3OS2 and a molecular weight of 317.44 g/mol. Its IUPAC name is N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]cyclopropanecarboxamide.
| Compound Name | N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 164687675 |
| Molecular Formula | C15H15N3OS2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]carbamothioyl]cyclopropanecarboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=S)NC(=O)C3CC3)n2)cc1 |
| InChI | InChI=1S/C15H15N3OS2/c1-9-2-4-10(5-3-9)12-8-21-15(16-12)18-14(20)17-13(19)11-6-7-11/h2-5,8,11H,6-7H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | DOCNHPAZFMWHFI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|