C14H13BrN2OS — CID 1225742
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]cyclobutanecarboxamide (PubChem CID 1225742) has the molecular formula C14H13BrN2OS and a molecular weight of 337.24 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]cyclobutanecarboxamide.
| Compound Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 1225742 |
| Molecular Formula | C14H13BrN2OS |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]cyclobutanecarboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(Br)cc2)cs1)C1CCC1 |
| InChI | InChI=1S/C14H13BrN2OS/c15-11-6-4-9(5-7-11)12-8-19-14(16-12)17-13(18)10-2-1-3-10/h4-8,10H,1-3H2,(H,16,17,18) |
| InChIKey | GFJCCASFXVKFKJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |