C15H16N2O3S2 — CID 9246518
N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]cyclobutanecarboxamide (PubChem CID 9246518) has the molecular formula C15H16N2O3S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]cyclobutanecarboxamide.
| Compound Name | N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 9246518 |
| Molecular Formula | C15H16N2O3S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]cyclobutanecarboxamide |
| SMILES | CS(=O)(=O)c1ccc(-c2csc(NC(=O)C3CCC3)n2)cc1 |
| InChI | InChI=1S/C15H16N2O3S2/c1-22(19,20)12-7-5-10(6-8-12)13-9-21-15(16-13)17-14(18)11-3-2-4-11/h5-9,11H,2-4H2,1H3,(H,16,17,18) |
| InChIKey | CYUHOAZHFXXYGE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |