C20H15F3N2OS — CID 2120614
(E)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 2120614) has the molecular formula C20H15F3N2OS and a molecular weight of 388.41 g/mol. Its IUPAC name is (E)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 2120614 |
| Molecular Formula | C20H15F3N2OS |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (E)-N-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)/C=C/c3cccc(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C20H15F3N2OS/c1-13-5-8-15(9-6-13)17-12-27-19(24-17)25-18(26)10-7-14-3-2-4-16(11-14)20(21,22)23/h2-12H,1H3,(H,24,25,26)/b10-7+ |
| InChIKey | YIGGSTKFTHAHCQ-JXMROGBWSA-N |
| XLogP | 5.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|