C22H19F3N2OS — CID 5151766
3-[3-(trifluoromethyl)phenyl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 5151766) has the molecular formula C22H19F3N2OS and a molecular weight of 416.47 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-[3-(trifluoromethyl)phenyl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 5151766 |
| Molecular Formula | C22H19F3N2OS |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]-N-[4-(2,4,5-trimethylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)C=Cc3cccc(C(F)(F)F)c3)n2)cc1C |
| InChI | InChI=1S/C22H19F3N2OS/c1-13-9-15(3)18(10-14(13)2)19-12-29-21(26-19)27-20(28)8-7-16-5-4-6-17(11-16)22(23,24)25/h4-12H,1-3H3,(H,26,27,28) |
| InChIKey | KJFLVCXIQQCXEX-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|