C22H20Cl2N2OS — CID 5071825
N-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 5071825) has the molecular formula C22H20Cl2N2OS and a molecular weight of 431.39 g/mol. Its IUPAC name is N-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5071825 |
| Molecular Formula | C22H20Cl2N2OS |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | N-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(-c2csc(NC(=O)C=Cc3ccc(Cl)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C22H20Cl2N2OS/c1-22(2,3)16-8-6-15(7-9-16)19-13-28-21(25-19)26-20(27)11-5-14-4-10-17(23)18(24)12-14/h4-13H,1-3H3,(H,25,26,27) |
| InChIKey | NPZOXFCVBQVYKL-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|