C18H11BrCl2N2OS — CID 4161376
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 4161376) has the molecular formula C18H11BrCl2N2OS and a molecular weight of 454.18 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4161376 |
| Molecular Formula | C18H11BrCl2N2OS |
| Molecular Weight | 454.18 g/mol |
| Exact Mass | 451.92 |
| IUPAC Name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)Nc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C18H11BrCl2N2OS/c19-13-5-3-12(4-6-13)16-10-25-18(22-16)23-17(24)8-2-11-1-7-14(20)15(21)9-11/h1-10H,(H,22,23,24) |
| InChIKey | KUIALWVVPMVKIO-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.18 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|