C13H8Cl2N2O3S — CID 844119
4-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 844119) has the molecular formula C13H8Cl2N2O3S and a molecular weight of 343.19 g/mol. Its IUPAC name is 4-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 844119 |
| Molecular Formula | C13H8Cl2N2O3S |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 4-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C13H8Cl2N2O3S/c14-8-2-1-7(5-9(8)15)10-6-21-13(16-10)17-11(18)3-4-12(19)20/h1-6H,(H,19,20)(H,16,17,18) |
| InChIKey | UAULQPZMFYZMKH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|