C11H7BrCl2N2OS — CID 63678715
2-bromo-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 63678715) has the molecular formula C11H7BrCl2N2OS and a molecular weight of 366.07 g/mol. Its IUPAC name is 2-bromo-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-bromo-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 63678715 |
| Molecular Formula | C11H7BrCl2N2OS |
| Molecular Weight | 366.07 g/mol |
| Exact Mass | 363.88 |
| IUPAC Name | 2-bromo-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CBr)Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C11H7BrCl2N2OS/c12-4-10(17)16-11-15-9(5-18-11)6-1-2-7(13)8(14)3-6/h1-3,5H,4H2,(H,15,16,17) |
| InChIKey | UJVLSWWERYGDFW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.07 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|