C15H12Cl2N2O3S — CID 7981061
[2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-but-2-enoate (PubChem CID 7981061) has the molecular formula C15H12Cl2N2O3S and a molecular weight of 371.25 g/mol. Its IUPAC name is [2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-but-2-enoate.
| Compound Name | [2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 7981061 |
| Molecular Formula | C15H12Cl2N2O3S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | [2-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-2-oxoethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCC(=O)Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C15H12Cl2N2O3S/c1-2-3-14(21)22-7-13(20)19-15-18-12(8-23-15)9-4-5-10(16)11(17)6-9/h2-6,8H,7H2,1H3,(H,18,19,20)/b3-2+ |
| InChIKey | AHLKFNIRMTYRBP-NSCUHMNNSA-N |
| XLogP | 4.17 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|