C24H12Cl4N4O2S3 — CID 5121730
2-N,5-N-bis[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]thiophene-2,5-dicarboxamide (PubChem CID 5121730) has the molecular formula C24H12Cl4N4O2S3 and a molecular weight of 626.40 g/mol. Its IUPAC name is 2-N,5-N-bis[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]thiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 5121730 |
| Molecular Formula | C24H12Cl4N4O2S3 |
| Molecular Weight | 626.40 g/mol |
| Exact Mass | 623.89 |
| IUPAC Name | 2-N,5-N-bis[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]thiophene-2,5-dicarboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1)c1ccc(C(=O)Nc2nc(-c3ccc(Cl)c(Cl)c3)cs2)s1 |
| InChI | InChI=1S/C24H12Cl4N4O2S3/c25-13-3-1-11(7-15(13)27)17-9-35-23(29-17)31-21(33)19-5-6-20(37-19)22(34)32-24-30-18(10-36-24)12-2-4-14(26)16(28)8-12/h1-10H,(H,29,31,33)(H,30,32,34) |
| InChIKey | FQCPPNLUMATURG-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.40 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |