C16H11Cl2N3OS — CID 28861353
N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-3,4-dichlorobenzamide (PubChem CID 28861353) has the molecular formula C16H11Cl2N3OS and a molecular weight of 364.26 g/mol. Its IUPAC name is N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-3,4-dichlorobenzamide.
| Compound Name | N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 28861353 |
| Molecular Formula | C16H11Cl2N3OS |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-3,4-dichlorobenzamide |
| SMILES | Nc1ccc(-c2csc(NC(=O)c3ccc(Cl)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C16H11Cl2N3OS/c17-12-6-3-10(7-13(12)18)15(22)21-16-20-14(8-23-16)9-1-4-11(19)5-2-9/h1-8H,19H2,(H,20,21,22) |
| InChIKey | SYOLLRNOMRLRIP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|