C16H9Cl2N3O3S — CID 2314903
4-chloro-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide (PubChem CID 2314903) has the molecular formula C16H9Cl2N3O3S and a molecular weight of 394.24 g/mol. Its IUPAC name is 4-chloro-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 2314903 |
| Molecular Formula | C16H9Cl2N3O3S |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | 4-chloro-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
| SMILES | O=C(Nc1nc(-c2ccc(Cl)cc2)cs1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H9Cl2N3O3S/c17-11-4-1-9(2-5-11)13-8-25-16(19-13)20-15(22)10-3-6-12(18)14(7-10)21(23)24/h1-8H,(H,19,20,22) |
| InChIKey | BNKOJIOOYANVOS-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|