C17H11F2N3O5S2 — CID 26176205
N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-methylsulfonyl-3-nitrobenzamide (PubChem CID 26176205) has the molecular formula C17H11F2N3O5S2 and a molecular weight of 439.42 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-methylsulfonyl-3-nitrobenzamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-methylsulfonyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 26176205 |
| Molecular Formula | C17H11F2N3O5S2 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-methylsulfonyl-3-nitrobenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Nc2nc(-c3ccc(F)c(F)c3)cs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11F2N3O5S2/c1-29(26,27)15-5-3-10(7-14(15)22(24)25)16(23)21-17-20-13(8-28-17)9-2-4-11(18)12(19)6-9/h2-8H,1H3,(H,20,21,23) |
| InChIKey | RFTXGWPSPUQRFD-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 119.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|