C20H15Cl2N3O7S2 — CID 2413173
[(2R)-1-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 2413173) has the molecular formula C20H15Cl2N3O7S2 and a molecular weight of 544.39 g/mol. Its IUPAC name is [(2R)-1-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [(2R)-1-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2413173 |
| Molecular Formula | C20H15Cl2N3O7S2 |
| Molecular Weight | 544.39 g/mol |
| Exact Mass | 542.97 |
| IUPAC Name | [(2R)-1-[[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(S(C)(=O)=O)c([N+](=O)[O-])c1)C(=O)Nc1nc(-c2ccc(Cl)c(Cl)c2)cs1 |
| InChI | InChI=1S/C20H15Cl2N3O7S2/c1-10(32-19(27)12-4-6-17(34(2,30)31)16(8-12)25(28)29)18(26)24-20-23-15(9-33-20)11-3-5-13(21)14(22)7-11/h3-10H,1-2H3,(H,23,24,26)/t10-/m1/s1 |
| InChIKey | JNKDEVICIIJDJP-SNVBAGLBSA-N |
| XLogP | 4.61 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|