C16H9F2N3O3S — CID 8801401
N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-2-nitrobenzamide (PubChem CID 8801401) has the molecular formula C16H9F2N3O3S and a molecular weight of 361.33 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-2-nitrobenzamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 8801401 |
| Molecular Formula | C16H9F2N3O3S |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-2-nitrobenzamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)c(F)c2)cs1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H9F2N3O3S/c17-11-6-5-9(7-12(11)18)13-8-25-16(19-13)20-15(22)10-3-1-2-4-14(10)21(23)24/h1-8H,(H,19,20,22) |
| InChIKey | UVFVLKRKXHTRNS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|