C11H9N3O3S — CID 902953
N-(4-methyl-1,3-thiazol-2-yl)-2-nitrobenzamide (PubChem CID 902953) has the molecular formula C11H9N3O3S and a molecular weight of 263.28 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-2-nitrobenzamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 902953 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-2-nitrobenzamide |
| SMILES | Cc1csc(NC(=O)c2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H9N3O3S/c1-7-6-18-11(12-7)13-10(15)8-4-2-3-5-9(8)14(16)17/h2-6H,1H3,(H,12,13,15) |
| InChIKey | UESMENZTPUJSFR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|