C17H10N4O7S — CID 3110581
2-nitro-6-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]carbamoyl]benzoic acid (PubChem CID 3110581) has the molecular formula C17H10N4O7S and a molecular weight of 414.36 g/mol. Its IUPAC name is 2-nitro-6-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]carbamoyl]benzoic acid.
| Compound Name | 2-nitro-6-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 3110581 |
| Molecular Formula | C17H10N4O7S |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 2-nitro-6-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]carbamoyl]benzoic acid |
| SMILES | O=C(Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1)c1cccc([N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C17H10N4O7S/c22-15(11-5-2-6-13(21(27)28)14(11)16(23)24)19-17-18-12(8-29-17)9-3-1-4-10(7-9)20(25)26/h1-8H,(H,23,24)(H,18,19,22) |
| InChIKey | OFBIMNIZRZVWIM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 165.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|