About 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide
2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 60594278) has the molecular formula C17H12N4O5S
and a molecular weight of 384.40 g/mol. Its IUPAC name is 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide.
Molecular Properties
| Compound Name | 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide |
| PubChem CID | 60594278 |
| Molecular Formula | C17H12N4O5S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)NC2=NC(=CS2)C3=CC(=CC=C3)[N+](=O)[O-] |
| InChI | InChI=1S/C17H12N4O5S/c1-10-5-6-13(21(25)26)8-14(10)16(22)19-17-18-15(9-27-17)11-3-2-4-12(7-11)20(23)24/h2-9H,1H3,(H,18,19,22) |
| InChIKey | ABGGBSMXRVQTOU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 162.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | 581 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide?
The IUPAC name of 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide (CID 60594278) is 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide.
What is the SMILES notation for 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide?
The canonical SMILES for 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide is CC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)NC2=NC(=CS2)C3=CC(=CC=C3)[N+](=O)[O-].
What is the InChIKey of 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide?
The InChIKey is ABGGBSMXRVQTOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4O5S/c1-10-5-6-13(21(25)26)8-14(10)16(22)19-17-18-15(9-27-17)11-3-2-4-12(7-11)20(23)24/h2-9H,1H3,(H,18,19,22).
What are the key properties of 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide?
2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide has a molecular weight of 384.40 g/mol, XLogP of 3.80, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide is sourced from PubChem (CID 60594278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).