C13H8N4O4S — CID 16804300
N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-1,2-oxazole-5-carboxamide (PubChem CID 16804300) has the molecular formula C13H8N4O4S and a molecular weight of 316.30 g/mol. Its IUPAC name is N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 16804300 |
| Molecular Formula | C13H8N4O4S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-1,2-oxazole-5-carboxamide |
| SMILES | O=C(Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1)c1ccno1 |
| InChI | InChI=1S/C13H8N4O4S/c18-12(11-4-5-14-21-11)16-13-15-10(7-22-13)8-2-1-3-9(6-8)17(19)20/h1-7H,(H,15,16,18) |
| InChIKey | IBAPHQVNZZYWOC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|