C20H17N5O6S — CID 17110860
4-morpholin-4-yl-3-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 17110860) has the molecular formula C20H17N5O6S and a molecular weight of 455.45 g/mol. Its IUPAC name is 4-morpholin-4-yl-3-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-morpholin-4-yl-3-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 17110860 |
| Molecular Formula | C20H17N5O6S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 4-morpholin-4-yl-3-nitro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1)c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17N5O6S/c26-19(14-4-5-17(18(11-14)25(29)30)23-6-8-31-9-7-23)22-20-21-16(12-32-20)13-2-1-3-15(10-13)24(27)28/h1-5,10-12H,6-9H2,(H,21,22,26) |
| InChIKey | KQJXQNARRUFJCA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 140.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|