C22H21N5O6S — CID 16962105
[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 6-morpholin-4-ylpyridine-3-carboxylate (PubChem CID 16962105) has the molecular formula C22H21N5O6S and a molecular weight of 483.51 g/mol. Its IUPAC name is [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 6-morpholin-4-ylpyridine-3-carboxylate.
| Compound Name | [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 6-morpholin-4-ylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 16962105 |
| Molecular Formula | C22H21N5O6S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 6-morpholin-4-ylpyridine-3-carboxylate |
| SMILES | CC(OC(=O)c1ccc(N2CCOCC2)nc1)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C22H21N5O6S/c1-14(33-21(29)16-5-6-19(23-12-16)26-7-9-32-10-8-26)20(28)25-22-24-18(13-34-22)15-3-2-4-17(11-15)27(30)31/h2-6,11-14H,7-10H2,1H3,(H,24,25,28) |
| InChIKey | BANDSNHVXSWFHJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|