C21H15N3O6S — CID 40956565
[(2S)-1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate (PubChem CID 40956565) has the molecular formula C21H15N3O6S and a molecular weight of 437.43 g/mol. Its IUPAC name is [(2S)-1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate.
| Compound Name | [(2S)-1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 40956565 |
| Molecular Formula | C21H15N3O6S |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | [(2S)-1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 1-benzofuran-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc2ccccc2o1)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C21H15N3O6S/c1-12(29-20(26)18-10-14-5-2-3-8-17(14)30-18)19(25)23-21-22-16(11-31-21)13-6-4-7-15(9-13)24(27)28/h2-12H,1H3,(H,22,23,25)/t12-/m0/s1 |
| InChIKey | GUSINYJEBAONKL-LBPRGKRZSA-N |
| XLogP | 4.65 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|