C21H16N4O7S — CID 42978319
[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 42978319) has the molecular formula C21H16N4O7S and a molecular weight of 468.45 g/mol. Its IUPAC name is [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 42978319 |
| Molecular Formula | C21H16N4O7S |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | CC(OC(=O)Cn1c(=O)oc2ccccc21)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C21H16N4O7S/c1-12(31-18(26)10-24-16-7-2-3-8-17(16)32-21(24)28)19(27)23-20-22-15(11-33-20)13-5-4-6-14(9-13)25(29)30/h2-9,11-12H,10H2,1H3,(H,22,23,27) |
| InChIKey | FGBPRDAANRGMDA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 146.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|