C21H19N3O6S2 — CID 46811523
[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate (PubChem CID 46811523) has the molecular formula C21H19N3O6S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate.
| Compound Name | [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 46811523 |
| Molecular Formula | C21H19N3O6S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 4-(5-methylthiophen-2-yl)-4-oxobutanoate |
| SMILES | Cc1ccc(C(=O)CCC(=O)OC(C)C(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)s1 |
| InChI | InChI=1S/C21H19N3O6S2/c1-12-6-8-18(32-12)17(25)7-9-19(26)30-13(2)20(27)23-21-22-16(11-31-21)14-4-3-5-15(10-14)24(28)29/h3-6,8,10-11,13H,7,9H2,1-2H3,(H,22,23,27) |
| InChIKey | LFHCFCHQSDIRMA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|