C21H20N4O6S2 — CID 46695115
[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 3-acetamido-3-thiophen-2-ylpropanoate (PubChem CID 46695115) has the molecular formula C21H20N4O6S2 and a molecular weight of 488.55 g/mol. Its IUPAC name is [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 3-acetamido-3-thiophen-2-ylpropanoate.
| Compound Name | [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 3-acetamido-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 46695115 |
| Molecular Formula | C21H20N4O6S2 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 3-acetamido-3-thiophen-2-ylpropanoate |
| SMILES | CC(=O)NC(CC(=O)OC(C)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1)c1cccs1 |
| InChI | InChI=1S/C21H20N4O6S2/c1-12(31-19(27)10-16(22-13(2)26)18-7-4-8-32-18)20(28)24-21-23-17(11-33-21)14-5-3-6-15(9-14)25(29)30/h3-9,11-12,16H,10H2,1-2H3,(H,22,26)(H,23,24,28) |
| InChIKey | VGBBDFBAPOCNDY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|