C20H16FN3O6S — CID 55311068
[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 2-(4-fluorophenoxy)acetate (PubChem CID 55311068) has the molecular formula C20H16FN3O6S and a molecular weight of 445.43 g/mol. Its IUPAC name is [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 2-(4-fluorophenoxy)acetate.
| Compound Name | [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 2-(4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 55311068 |
| Molecular Formula | C20H16FN3O6S |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 2-(4-fluorophenoxy)acetate |
| SMILES | CC(OC(=O)COc1ccc(F)cc1)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C20H16FN3O6S/c1-12(30-18(25)10-29-16-7-5-14(21)6-8-16)19(26)23-20-22-17(11-31-20)13-3-2-4-15(9-13)24(27)28/h2-9,11-12H,10H2,1H3,(H,22,23,26) |
| InChIKey | QHCMBCYKCNGMLN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|