C20H15F2N3O6S — CID 40834193
[(2R)-1-[[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 2-(2-nitrophenoxy)acetate (PubChem CID 40834193) has the molecular formula C20H15F2N3O6S and a molecular weight of 463.42 g/mol. Its IUPAC name is [(2R)-1-[[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 2-(2-nitrophenoxy)acetate.
| Compound Name | [(2R)-1-[[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 40834193 |
| Molecular Formula | C20H15F2N3O6S |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | [(2R)-1-[[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 2-(2-nitrophenoxy)acetate |
| SMILES | C[C@@H](OC(=O)COc1ccccc1[N+](=O)[O-])C(=O)Nc1nc(-c2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C20H15F2N3O6S/c1-11(31-18(26)9-30-17-5-3-2-4-16(17)25(28)29)19(27)24-20-23-15(10-32-20)12-6-7-13(21)14(22)8-12/h2-8,10-11H,9H2,1H3,(H,23,24,27)/t11-/m1/s1 |
| InChIKey | DEGGSFXYTZIIJV-LLVKDONJSA-N |
| XLogP | 3.95 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|